C15H20ClNO4 — CID 107562859
(2R)-2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]pentanoic acid (PubChem CID 107562859) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is (2R)-2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]pentanoic acid.
| Compound Name | (2R)-2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107562859 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2R)-2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)C(C)(C)Oc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H20ClNO4/c1-4-5-12(13(18)19)17-14(20)15(2,3)21-11-8-6-10(16)7-9-11/h6-9,12H,4-5H2,1-3H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | QNMKCTNCXAHJSB-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |