(2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid

C15H21NO4 — CID 107563565

IUPAC(2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid
SMILESCCC[C@@H](NC(=O)COc1cc(C)cc(C)c1)C(=O)O
InChIInChI=1S/C15H21NO4/c1-4-5-13(15(18)19)16-14(17)9-20-12-7-10(2)6-11(3)8-12/h6-8,13H,4-5,9H2,1-3H3,(H,16,17)(H,18,19)/t13-/m1/s1
InChIKeyYBEGZJVLBBQKAJ-CYBMUJFWSA-N
MW279.34 g/mol
LogP2.05
Rot. Bonds7

About (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid

(2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid (PubChem CID 107563565) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid.

Molecular Properties

Compound Name(2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid
PubChem CID107563565
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC Name(2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid
SMILESCCC[C@@H](NC(=O)COc1cc(C)cc(C)c1)C(=O)O
InChIInChI=1S/C15H21NO4/c1-4-5-13(15(18)19)16-14(17)9-20-12-7-10(2)6-11(3)8-12/h6-8,13H,4-5,9H2,1-3H3,(H,16,17)(H,18,19)/t13-/m1/s1
InChIKeyYBEGZJVLBBQKAJ-CYBMUJFWSA-N
XLogP2.05
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid?
The IUPAC name of (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid (CID 107563565) is (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid.
What is the SMILES notation for (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid?
The canonical SMILES for (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid is CCC[C@@H](NC(=O)COc1cc(C)cc(C)c1)C(=O)O.
What is the InChIKey of (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid?
The InChIKey is YBEGZJVLBBQKAJ-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H21NO4/c1-4-5-13(15(18)19)16-14(17)9-20-12-7-10(2)6-11(3)8-12/h6-8,13H,4-5,9H2,1-3H3,(H,16,17)(H,18,19)/t13-/m1/s1.
What are the key properties of (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid?
(2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid has a molecular weight of 279.34 g/mol, XLogP of 2.05, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]pentanoic acid is sourced from PubChem (CID 107563565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).