C13H20N4O3S — CID 107565977
(2S)-2-[[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]amino]pentanoic acid (PubChem CID 107565977) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is (2S)-2-[[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107565977 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (2S)-2-[[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)N1CCN(c2nccs2)CC1)C(=O)O |
| InChI | InChI=1S/C13H20N4O3S/c1-2-3-10(11(18)19)15-12(20)16-5-7-17(8-6-16)13-14-4-9-21-13/h4,9-10H,2-3,5-8H2,1H3,(H,15,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | VYICIIJDUFBGHL-JTQLQIEISA-N |
| XLogP | 1.23 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |