C15H28N2O3 — CID 107567070
(2R)-2-[2-(4-methylcyclohexyl)ethylcarbamoylamino]pentanoic acid (PubChem CID 107567070) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R)-2-[2-(4-methylcyclohexyl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | (2R)-2-[2-(4-methylcyclohexyl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107567070 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (2R)-2-[2-(4-methylcyclohexyl)ethylcarbamoylamino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)NCCC1CCC(C)CC1)C(=O)O |
| InChI | InChI=1S/C15H28N2O3/c1-3-4-13(14(18)19)17-15(20)16-10-9-12-7-5-11(2)6-8-12/h11-13H,3-10H2,1-2H3,(H,18,19)(H2,16,17,20)/t11?,12?,13-/m1/s1 |
| InChIKey | YPRMJNZBLDVPHV-WXRRBKDZSA-N |
| XLogP | 2.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |