C15H13F5O — CID 10756876
[(1E)-5-ethoxy-6,6,7,7,7-pentafluorohepta-1,3,4-trienyl]benzene (PubChem CID 10756876) has the molecular formula C15H13F5O and a molecular weight of 304.26 g/mol. Its IUPAC name is [(1E)-5-ethoxy-6,6,7,7,7-pentafluorohepta-1,3,4-trienyl]benzene.
| Compound Name | [(1E)-5-ethoxy-6,6,7,7,7-pentafluorohepta-1,3,4-trienyl]benzene |
|---|---|
| PubChem CID | 10756876 |
| Molecular Formula | C15H13F5O |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [(1E)-5-ethoxy-6,6,7,7,7-pentafluorohepta-1,3,4-trienyl]benzene |
| SMILES | CCOC(=C=C/C=C/c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F5O/c1-2-21-13(14(16,17)15(18,19)20)11-7-6-10-12-8-4-3-5-9-12/h3-10H,2H2,1H3/b10-6+ |
| InChIKey | ONFLUGSZBGDPJL-UXBLZVDNSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|