C12H19N3O2 — CID 107570145
(2S)-2-amino-N-(6-ethoxy-3-pyridinyl)pentanamide (PubChem CID 107570145) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2S)-2-amino-N-(6-ethoxy-3-pyridinyl)pentanamide.
| Compound Name | (2S)-2-amino-N-(6-ethoxy-3-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 107570145 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2S)-2-amino-N-(6-ethoxy-3-pyridinyl)pentanamide |
| SMILES | CCC[C@H](N)C(=O)Nc1ccc(OCC)nc1 |
| InChI | InChI=1S/C12H19N3O2/c1-3-5-10(13)12(16)15-9-6-7-11(14-8-9)17-4-2/h6-8,10H,3-5,13H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | KJCSNVZIPSLCFB-JTQLQIEISA-N |
| XLogP | 1.55 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |