C17H22BrN — CID 107571952
N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-4-bromo-3,5-dimethylaniline (PubChem CID 107571952) has the molecular formula C17H22BrN and a molecular weight of 320.27 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-4-bromo-3,5-dimethylaniline.
| Compound Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-4-bromo-3,5-dimethylaniline |
|---|---|
| PubChem CID | 107571952 |
| Molecular Formula | C17H22BrN |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-4-bromo-3,5-dimethylaniline |
| SMILES | Cc1cc(NC(C)C2CC3C=CC2C3)cc(C)c1Br |
| InChI | InChI=1S/C17H22BrN/c1-10-6-15(7-11(2)17(10)18)19-12(3)16-9-13-4-5-14(16)8-13/h4-7,12-14,16,19H,8-9H2,1-3H3 |
| InChIKey | LWKKXZFDQBBDOJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|