C16H17BrFNO — CID 107572030
2-[1-(4-bromo-3,5-dimethylanilino)ethyl]-5-fluorophenol (PubChem CID 107572030) has the molecular formula C16H17BrFNO and a molecular weight of 338.22 g/mol. Its IUPAC name is 2-[1-(4-bromo-3,5-dimethylanilino)ethyl]-5-fluorophenol.
| Compound Name | 2-[1-(4-bromo-3,5-dimethylanilino)ethyl]-5-fluorophenol |
|---|---|
| PubChem CID | 107572030 |
| Molecular Formula | C16H17BrFNO |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[1-(4-bromo-3,5-dimethylanilino)ethyl]-5-fluorophenol |
| SMILES | Cc1cc(NC(C)c2ccc(F)cc2O)cc(C)c1Br |
| InChI | InChI=1S/C16H17BrFNO/c1-9-6-13(7-10(2)16(9)17)19-11(3)14-5-4-12(18)8-15(14)20/h4-8,11,19-20H,1-3H3 |
| InChIKey | VVEVUGJIPCWQIR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|