C16H18FNO2 — CID 63064990
3-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-2,6-dimethylphenol (PubChem CID 63064990) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-2,6-dimethylphenol.
| Compound Name | 3-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 63064990 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-[1-(4-fluoro-2-hydroxyphenyl)ethylamino]-2,6-dimethylphenol |
| SMILES | Cc1ccc(NC(C)c2ccc(F)cc2O)c(C)c1O |
| InChI | InChI=1S/C16H18FNO2/c1-9-4-7-14(10(2)16(9)20)18-11(3)13-6-5-12(17)8-15(13)19/h4-8,11,18-20H,1-3H3 |
| InChIKey | CTORZUFWKASRRQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|