C15H14Cl2FNO2 — CID 107572598
2-[(3,5-dichloro-4-fluoroanilino)methyl]-6-ethoxyphenol (PubChem CID 107572598) has the molecular formula C15H14Cl2FNO2 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-fluoroanilino)methyl]-6-ethoxyphenol.
| Compound Name | 2-[(3,5-dichloro-4-fluoroanilino)methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 107572598 |
| Molecular Formula | C15H14Cl2FNO2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-[(3,5-dichloro-4-fluoroanilino)methyl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(CNc2cc(Cl)c(F)c(Cl)c2)c1O |
| InChI | InChI=1S/C15H14Cl2FNO2/c1-2-21-13-5-3-4-9(15(13)20)8-19-10-6-11(16)14(18)12(17)7-10/h3-7,19-20H,2,8H2,1H3 |
| InChIKey | NQISOYBAQMSRCU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|