C12H8BrCl2FN2 — CID 107572987
N-[(5-bromo-2-pyridinyl)methyl]-3,5-dichloro-4-fluoroaniline (PubChem CID 107572987) has the molecular formula C12H8BrCl2FN2 and a molecular weight of 350.02 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]-3,5-dichloro-4-fluoroaniline.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]-3,5-dichloro-4-fluoroaniline |
|---|---|
| PubChem CID | 107572987 |
| Molecular Formula | C12H8BrCl2FN2 |
| Molecular Weight | 350.02 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]-3,5-dichloro-4-fluoroaniline |
| SMILES | Fc1c(Cl)cc(NCc2ccc(Br)cn2)cc1Cl |
| InChI | InChI=1S/C12H8BrCl2FN2/c13-7-1-2-8(17-5-7)6-18-9-3-10(14)12(16)11(15)4-9/h1-5,18H,6H2 |
| InChIKey | WBTZZCXRUPKUOV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.02 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|