C14H21BrN2O2S — CID 107575648
N-(4-bromo-3,5-dimethylphenyl)-1-piperidin-2-ylmethanesulfonamide (PubChem CID 107575648) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-1-piperidin-2-ylmethanesulfonamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-1-piperidin-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 107575648 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-1-piperidin-2-ylmethanesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CC2CCCCN2)cc(C)c1Br |
| InChI | InChI=1S/C14H21BrN2O2S/c1-10-7-13(8-11(2)14(10)15)17-20(18,19)9-12-5-3-4-6-16-12/h7-8,12,16-17H,3-6,9H2,1-2H3 |
| InChIKey | UQYUUDGLQKADNM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |