C9H14BrN3O2S2 — CID 54974227
N-(5-bromo-1,3-thiazol-2-yl)-1-piperidin-2-ylmethanesulfonamide (PubChem CID 54974227) has the molecular formula C9H14BrN3O2S2 and a molecular weight of 340.27 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-1-piperidin-2-ylmethanesulfonamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-1-piperidin-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 54974227 |
| Molecular Formula | C9H14BrN3O2S2 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-1-piperidin-2-ylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CCCCN1)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C9H14BrN3O2S2/c10-8-5-12-9(16-8)13-17(14,15)6-7-3-1-2-4-11-7/h5,7,11H,1-4,6H2,(H,12,13) |
| InChIKey | VORYODVMKAMGLU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |