C12H11Cl2FN2O4 — CID 107576429
4-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]oxolane-3-carboxylic acid (PubChem CID 107576429) has the molecular formula C12H11Cl2FN2O4 and a molecular weight of 337.13 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 107576429 |
| Molecular Formula | C12H11Cl2FN2O4 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]oxolane-3-carboxylic acid |
| SMILES | O=C(Nc1cc(Cl)c(F)c(Cl)c1)NC1COCC1C(=O)O |
| InChI | InChI=1S/C12H11Cl2FN2O4/c13-7-1-5(2-8(14)10(7)15)16-12(20)17-9-4-21-3-6(9)11(18)19/h1-2,6,9H,3-4H2,(H,18,19)(H2,16,17,20) |
| InChIKey | BOOZYSHFGRFEOG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|