C13H11Cl2FN2S — CID 107577212
4-cyclopropyl-5-[(3,5-dichloro-4-fluorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 107577212) has the molecular formula C13H11Cl2FN2S and a molecular weight of 317.22 g/mol. Its IUPAC name is 4-cyclopropyl-5-[(3,5-dichloro-4-fluorophenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-cyclopropyl-5-[(3,5-dichloro-4-fluorophenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107577212 |
| Molecular Formula | C13H11Cl2FN2S |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 4-cyclopropyl-5-[(3,5-dichloro-4-fluorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C2CC2)c(Cc2cc(Cl)c(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C13H11Cl2FN2S/c14-8-3-6(4-9(15)11(8)16)5-10-12(7-1-2-7)18-13(17)19-10/h3-4,7H,1-2,5H2,(H2,17,18) |
| InChIKey | JYYONJGAWULCCY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|