C13H11BrF2N2S — CID 107615264
5-[(4-bromo-2,5-difluorophenyl)methyl]-4-cyclopropyl-1,3-thiazol-2-amine (PubChem CID 107615264) has the molecular formula C13H11BrF2N2S and a molecular weight of 345.21 g/mol. Its IUPAC name is 5-[(4-bromo-2,5-difluorophenyl)methyl]-4-cyclopropyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(4-bromo-2,5-difluorophenyl)methyl]-4-cyclopropyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107615264 |
| Molecular Formula | C13H11BrF2N2S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 5-[(4-bromo-2,5-difluorophenyl)methyl]-4-cyclopropyl-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C2CC2)c(Cc2cc(F)c(Br)cc2F)s1 |
| InChI | InChI=1S/C13H11BrF2N2S/c14-8-5-9(15)7(3-10(8)16)4-11-12(6-1-2-6)18-13(17)19-11/h3,5-6H,1-2,4H2,(H2,17,18) |
| InChIKey | IAZRBNSIHAQHMX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|