C16H12O5S — CID 10757764
1-(8-acetyl-10,10-dioxophenoxathiin-3-yl)ethanone (PubChem CID 10757764) has the molecular formula C16H12O5S and a molecular weight of 316.33 g/mol. Its IUPAC name is 1-(8-acetyl-10,10-dioxophenoxathiin-3-yl)ethanone.
| Compound Name | 1-(8-acetyl-10,10-dioxophenoxathiin-3-yl)ethanone |
|---|---|
| PubChem CID | 10757764 |
| Molecular Formula | C16H12O5S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 1-(8-acetyl-10,10-dioxophenoxathiin-3-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)Oc1ccc(C(C)=O)cc1S2(=O)=O |
| InChI | InChI=1S/C16H12O5S/c1-9(17)11-4-6-15-14(7-11)21-13-5-3-12(10(2)18)8-16(13)22(15,19)20/h3-8H,1-2H3 |
| InChIKey | BPQFBIOMKSUYNQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |