C18H25NO2 — CID 107578011
N-[3-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-3,4,4-trimethylpentanamide (PubChem CID 107578011) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is N-[3-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-3,4,4-trimethylpentanamide.
| Compound Name | N-[3-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 107578011 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[3-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-3,4,4-trimethylpentanamide |
| SMILES | Cc1cc(C#CCO)cc(NC(=O)CC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H25NO2/c1-13-9-15(7-6-8-20)12-16(10-13)19-17(21)11-14(2)18(3,4)5/h9-10,12,14,20H,8,11H2,1-5H3,(H,19,21) |
| InChIKey | SDCUWOPCUNDIRQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|