C17H18N2O2 — CID 107578437
N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-3-(furan-2-yl)propanamide (PubChem CID 107578437) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 107578437 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-3-(furan-2-yl)propanamide |
| SMILES | Cc1cc(C#CCN)cc(NC(=O)CCc2ccco2)c1 |
| InChI | InChI=1S/C17H18N2O2/c1-13-10-14(4-2-8-18)12-15(11-13)19-17(20)7-6-16-5-3-9-21-16/h3,5,9-12H,6-8,18H2,1H3,(H,19,20) |
| InChIKey | VYZJUUFTZRHJPF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|