C15H13Cl2N3O — CID 107578473
N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-4,5-dichloro-1H-pyrrole-2-carboxamide (PubChem CID 107578473) has the molecular formula C15H13Cl2N3O and a molecular weight of 322.20 g/mol. Its IUPAC name is N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-4,5-dichloro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-4,5-dichloro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107578473 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[3-(3-aminoprop-1-ynyl)-5-methylphenyl]-4,5-dichloro-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(C#CCN)cc(NC(=O)c2cc(Cl)c(Cl)[nH]2)c1 |
| InChI | InChI=1S/C15H13Cl2N3O/c1-9-5-10(3-2-4-18)7-11(6-9)19-15(21)13-8-12(16)14(17)20-13/h5-8,20H,4,18H2,1H3,(H,19,21) |
| InChIKey | VRFYVQLNHVXWBG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|