C13H13Cl2FN2O — CID 107578795
5,7-dichloro-N-ethyl-6-fluoro-2-(methoxymethyl)quinolin-4-amine (PubChem CID 107578795) has the molecular formula C13H13Cl2FN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is 5,7-dichloro-N-ethyl-6-fluoro-2-(methoxymethyl)quinolin-4-amine.
| Compound Name | 5,7-dichloro-N-ethyl-6-fluoro-2-(methoxymethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 107578795 |
| Molecular Formula | C13H13Cl2FN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5,7-dichloro-N-ethyl-6-fluoro-2-(methoxymethyl)quinolin-4-amine |
| SMILES | CCNc1cc(COC)nc2cc(Cl)c(F)c(Cl)c12 |
| InChI | InChI=1S/C13H13Cl2FN2O/c1-3-17-9-4-7(6-19-2)18-10-5-8(14)13(16)12(15)11(9)10/h4-5H,3,6H2,1-2H3,(H,17,18) |
| InChIKey | CZFRDYHJEAVXOT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|