C12H9Cl3FN — CID 107577483
4,5,7-trichloro-6-fluoro-2-propylquinoline (PubChem CID 107577483) has the molecular formula C12H9Cl3FN and a molecular weight of 292.57 g/mol. Its IUPAC name is 4,5,7-trichloro-6-fluoro-2-propylquinoline.
| Compound Name | 4,5,7-trichloro-6-fluoro-2-propylquinoline |
|---|---|
| PubChem CID | 107577483 |
| Molecular Formula | C12H9Cl3FN |
| Molecular Weight | 292.57 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 4,5,7-trichloro-6-fluoro-2-propylquinoline |
| SMILES | CCCc1cc(Cl)c2c(Cl)c(F)c(Cl)cc2n1 |
| InChI | InChI=1S/C12H9Cl3FN/c1-2-3-6-4-7(13)10-9(17-6)5-8(14)12(16)11(10)15/h4-5H,2-3H2,1H3 |
| InChIKey | PPYHBZOAHUBNDH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|