C14H15Cl2FN2 — CID 107579458
5,7-dichloro-N-ethyl-6-fluoro-3-propylquinolin-2-amine (PubChem CID 107579458) has the molecular formula C14H15Cl2FN2 and a molecular weight of 301.19 g/mol. Its IUPAC name is 5,7-dichloro-N-ethyl-6-fluoro-3-propylquinolin-2-amine.
| Compound Name | 5,7-dichloro-N-ethyl-6-fluoro-3-propylquinolin-2-amine |
|---|---|
| PubChem CID | 107579458 |
| Molecular Formula | C14H15Cl2FN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 5,7-dichloro-N-ethyl-6-fluoro-3-propylquinolin-2-amine |
| SMILES | CCCc1cc2c(Cl)c(F)c(Cl)cc2nc1NCC |
| InChI | InChI=1S/C14H15Cl2FN2/c1-3-5-8-6-9-11(19-14(8)18-4-2)7-10(15)13(17)12(9)16/h6-7H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | DJNQQYSSMWAVBM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|