C12H13BrClN3 — CID 107579140
1-(4-bromo-3,5-dimethylphenyl)-4-(2-chloroethyl)triazole (PubChem CID 107579140) has the molecular formula C12H13BrClN3 and a molecular weight of 314.61 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-4-(2-chloroethyl)triazole.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-4-(2-chloroethyl)triazole |
|---|---|
| PubChem CID | 107579140 |
| Molecular Formula | C12H13BrClN3 |
| Molecular Weight | 314.61 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-4-(2-chloroethyl)triazole |
| SMILES | Cc1cc(-n2cc(CCCl)nn2)cc(C)c1Br |
| InChI | InChI=1S/C12H13BrClN3/c1-8-5-11(6-9(2)12(8)13)17-7-10(3-4-14)15-16-17/h5-7H,3-4H2,1-2H3 |
| InChIKey | URAGFPJBRMIGBX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|