C13H14ClN3O2 — CID 62401184
4-(2-chloroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)triazole (PubChem CID 62401184) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)triazole.
| Compound Name | 4-(2-chloroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)triazole |
|---|---|
| PubChem CID | 62401184 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-(2-chloroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)triazole |
| SMILES | ClCCc1cn(-c2ccc3c(c2)OCCCO3)nn1 |
| InChI | InChI=1S/C13H14ClN3O2/c14-5-4-10-9-17(16-15-10)11-2-3-12-13(8-11)19-7-1-6-18-12/h2-3,8-9H,1,4-7H2 |
| InChIKey | DKNGSSDTQCPSIQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|