C11H10BrN3O2 — CID 55066662
4-(bromomethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazole (PubChem CID 55066662) has the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazole.
| Compound Name | 4-(bromomethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazole |
|---|---|
| PubChem CID | 55066662 |
| Molecular Formula | C11H10BrN3O2 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 4-(bromomethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazole |
| SMILES | BrCc1cn(-c2ccc3c(c2)OCCO3)nn1 |
| InChI | InChI=1S/C11H10BrN3O2/c12-6-8-7-15(14-13-8)9-1-2-10-11(5-9)17-4-3-16-10/h1-2,5,7H,3-4,6H2 |
| InChIKey | SDEQSYQPDSWQBN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|