C11H11N3O3 — CID 55066745
[1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol (PubChem CID 55066745) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol.
| Compound Name | [1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 55066745 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2ccc3c(c2)OCCO3)nn1 |
| InChI | InChI=1S/C11H11N3O3/c15-7-8-6-14(13-12-8)9-1-2-10-11(5-9)17-4-3-16-10/h1-2,5-6,15H,3-4,7H2 |
| InChIKey | FRSRKIWOFXINSV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |