C18H16ClFN4O2 — CID 166384443
N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-N-methyl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 166384443) has the molecular formula C18H16ClFN4O2 and a molecular weight of 374.80 g/mol. Its IUPAC name is N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-N-methyl-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-N-methyl-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 166384443 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-N-methyl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CN(Cc1cn(-c2ccc(F)c(Cl)c2)nn1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H16ClFN4O2/c1-23(13-3-5-17-18(9-13)26-7-6-25-17)10-12-11-24(22-21-12)14-2-4-16(20)15(19)8-14/h2-5,8-9,11H,6-7,10H2,1H3 |
| InChIKey | CBVLHQCHFQUSBR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|