C14H11ClFN5O — CID 130309886
2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-methylpyrimidine (PubChem CID 130309886) has the molecular formula C14H11ClFN5O and a molecular weight of 319.73 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-methylpyrimidine.
| Compound Name | 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-methylpyrimidine |
|---|---|
| PubChem CID | 130309886 |
| Molecular Formula | C14H11ClFN5O |
| Molecular Weight | 319.73 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-methylpyrimidine |
| SMILES | Cc1cnc(OCc2cn(-c3ccc(F)c(Cl)c3)nn2)nc1 |
| InChI | InChI=1S/C14H11ClFN5O/c1-9-5-17-14(18-6-9)22-8-10-7-21(20-19-10)11-2-3-13(16)12(15)4-11/h2-7H,8H2,1H3 |
| InChIKey | ZVBYAYLUIRDWCH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |