C15H14FN5O — CID 130309441
2-[[1-(4-fluoro-3-methylphenyl)triazol-4-yl]methoxy]-5-methylpyrimidine (PubChem CID 130309441) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-[[1-(4-fluoro-3-methylphenyl)triazol-4-yl]methoxy]-5-methylpyrimidine.
| Compound Name | 2-[[1-(4-fluoro-3-methylphenyl)triazol-4-yl]methoxy]-5-methylpyrimidine |
|---|---|
| PubChem CID | 130309441 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[[1-(4-fluoro-3-methylphenyl)triazol-4-yl]methoxy]-5-methylpyrimidine |
| SMILES | Cc1cnc(OCc2cn(-c3ccc(F)c(C)c3)nn2)nc1 |
| InChI | InChI=1S/C15H14FN5O/c1-10-6-17-15(18-7-10)22-9-12-8-21(20-19-12)13-3-4-14(16)11(2)5-13/h3-8H,9H2,1-2H3 |
| InChIKey | XVXPBMJKCJQWIF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |