C15H13ClFN5O — CID 130309889
2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-ethylpyrimidine (PubChem CID 130309889) has the molecular formula C15H13ClFN5O and a molecular weight of 333.75 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-ethylpyrimidine.
| Compound Name | 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-ethylpyrimidine |
|---|---|
| PubChem CID | 130309889 |
| Molecular Formula | C15H13ClFN5O |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methoxy]-5-ethylpyrimidine |
| SMILES | CCc1cnc(OCc2cn(-c3ccc(F)c(Cl)c3)nn2)nc1 |
| InChI | InChI=1S/C15H13ClFN5O/c1-2-10-6-18-15(19-7-10)23-9-11-8-22(21-20-11)12-3-4-14(17)13(16)5-12/h3-8H,2,9H2,1H3 |
| InChIKey | HULXCRLXLOALTM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |