C15H12F3N5O — CID 130302350
2-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-5-methylpyrimidine (PubChem CID 130302350) has the molecular formula C15H12F3N5O and a molecular weight of 335.29 g/mol. Its IUPAC name is 2-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-5-methylpyrimidine.
| Compound Name | 2-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-5-methylpyrimidine |
|---|---|
| PubChem CID | 130302350 |
| Molecular Formula | C15H12F3N5O |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-5-methylpyrimidine |
| SMILES | Cc1cnc(OCc2cn(-c3ccc(F)c(C(F)F)c3)nn2)nc1 |
| InChI | InChI=1S/C15H12F3N5O/c1-9-5-19-15(20-6-9)24-8-10-7-23(22-21-10)11-2-3-13(16)12(4-11)14(17)18/h2-7,14H,8H2,1H3 |
| InChIKey | HOYXXXFMZLRNFX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |