C10H7ClF3N3 — CID 118870094
4-(chloromethyl)-1-[3-(difluoromethyl)-4-fluorophenyl]triazole (PubChem CID 118870094) has the molecular formula C10H7ClF3N3 and a molecular weight of 261.63 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[3-(difluoromethyl)-4-fluorophenyl]triazole.
| Compound Name | 4-(chloromethyl)-1-[3-(difluoromethyl)-4-fluorophenyl]triazole |
|---|---|
| PubChem CID | 118870094 |
| Molecular Formula | C10H7ClF3N3 |
| Molecular Weight | 261.63 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 4-(chloromethyl)-1-[3-(difluoromethyl)-4-fluorophenyl]triazole |
| SMILES | Fc1ccc(-n2cc(CCl)nn2)cc1C(F)F |
| InChI | InChI=1S/C10H7ClF3N3/c11-4-6-5-17(16-15-6)7-1-2-9(12)8(3-7)10(13)14/h1-3,5,10H,4H2 |
| InChIKey | QCJVMOHVFAZSQX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.63 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|