C14H11F3N6 — CID 130309389
N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]pyrimidin-2-amine (PubChem CID 130309389) has the molecular formula C14H11F3N6 and a molecular weight of 320.28 g/mol. Its IUPAC name is N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]pyrimidin-2-amine.
| Compound Name | N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 130309389 |
| Molecular Formula | C14H11F3N6 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(-n2cc(CNc3ncccn3)nn2)cc1C(F)F |
| InChI | InChI=1S/C14H11F3N6/c15-12-3-2-10(6-11(12)13(16)17)23-8-9(21-22-23)7-20-14-18-4-1-5-19-14/h1-6,8,13H,7H2,(H,18,19,20) |
| InChIKey | CZBQMARLVKYCAM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |