C14H13F3N6 — CID 130309457
N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]-1-methylpyrazol-3-amine (PubChem CID 130309457) has the molecular formula C14H13F3N6 and a molecular weight of 322.29 g/mol. Its IUPAC name is N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]-1-methylpyrazol-3-amine.
| Compound Name | N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 130309457 |
| Molecular Formula | C14H13F3N6 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[[1-[3-(difluoromethyl)-4-fluorophenyl]triazol-4-yl]methyl]-1-methylpyrazol-3-amine |
| SMILES | Cn1ccc(NCc2cn(-c3ccc(F)c(C(F)F)c3)nn2)n1 |
| InChI | InChI=1S/C14H13F3N6/c1-22-5-4-13(20-22)18-7-9-8-23(21-19-9)10-2-3-12(15)11(6-10)14(16)17/h2-6,8,14H,7H2,1H3,(H,18,20) |
| InChIKey | SKUGIXWAKLKUGW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |