C14H10ClF2N5 — CID 174934349
5-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]pyrimidine (PubChem CID 174934349) has the molecular formula C14H10ClF2N5 and a molecular weight of 321.72 g/mol. Its IUPAC name is 5-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]pyrimidine.
| Compound Name | 5-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 174934349 |
| Molecular Formula | C14H10ClF2N5 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]pyrimidine |
| SMILES | FC(F)c1cc(-n2cc(Cc3cncnc3)nn2)ccc1Cl |
| InChI | InChI=1S/C14H10ClF2N5/c15-13-2-1-11(4-12(13)14(16)17)22-7-10(20-21-22)3-9-5-18-8-19-6-9/h1-2,4-8,14H,3H2 |
| InChIKey | DWDKKZYLADDEPD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |