C18H11ClF2N4O2 — CID 130302384
2-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]isoindole-1,3-dione (PubChem CID 130302384) has the molecular formula C18H11ClF2N4O2 and a molecular weight of 388.76 g/mol. Its IUPAC name is 2-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 130302384 |
| Molecular Formula | C18H11ClF2N4O2 |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-[[1-[4-chloro-3-(difluoromethyl)phenyl]triazol-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cn(-c2ccc(Cl)c(C(F)F)c2)nn1 |
| InChI | InChI=1S/C18H11ClF2N4O2/c19-15-6-5-11(7-14(15)16(20)21)25-9-10(22-23-25)8-24-17(26)12-3-1-2-4-13(12)18(24)27/h1-7,9,16H,8H2 |
| InChIKey | CGUVFOUWWYXECY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|