C21H12N4O4 — CID 73351877
2-[[1-(1,4-dioxonaphthalen-2-yl)triazol-4-yl]methyl]isoindole-1,3-dione (PubChem CID 73351877) has the molecular formula C21H12N4O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 2-[[1-(1,4-dioxonaphthalen-2-yl)triazol-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-(1,4-dioxonaphthalen-2-yl)triazol-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 73351877 |
| Molecular Formula | C21H12N4O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[[1-(1,4-dioxonaphthalen-2-yl)triazol-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1C=C(n2cc(CN3C(=O)c4ccccc4C3=O)nn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H12N4O4/c26-18-9-17(19(27)14-6-2-1-5-13(14)18)25-11-12(22-23-25)10-24-20(28)15-7-3-4-8-16(15)21(24)29/h1-9,11H,10H2 |
| InChIKey | UAJQWCLINHYYJV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|