C17H15N7O4 — CID 138967463
2-[3-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]propyl]isoindole-1,3-dione (PubChem CID 138967463) has the molecular formula C17H15N7O4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-[3-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138967463 |
| Molecular Formula | C17H15N7O4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[3-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCn1cc(Cn2ccnc2[N+](=O)[O-])nn1 |
| InChI | InChI=1S/C17H15N7O4/c25-15-13-4-1-2-5-14(13)16(26)23(15)8-3-7-22-11-12(19-20-22)10-21-9-6-18-17(21)24(27)28/h1-2,4-6,9,11H,3,7-8,10H2 |
| InChIKey | GIZKTFUEGPKDTR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|