C15H14N4O4 — CID 18356907
2-[4-(4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione (PubChem CID 18356907) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[4-(4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18356907 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[4-(4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCn1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N4O4/c20-14-11-5-1-2-6-12(11)15(21)18(14)8-4-3-7-17-9-13(16-10-17)19(22)23/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | IBZGEYQYVLYFGN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|