C18H20N6O2 — CID 122214824
3-(2-nitroimidazol-1-yl)-N,N-bis(pyridin-2-ylmethyl)propan-1-amine (PubChem CID 122214824) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 3-(2-nitroimidazol-1-yl)-N,N-bis(pyridin-2-ylmethyl)propan-1-amine.
| Compound Name | 3-(2-nitroimidazol-1-yl)-N,N-bis(pyridin-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 122214824 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-(2-nitroimidazol-1-yl)-N,N-bis(pyridin-2-ylmethyl)propan-1-amine |
| SMILES | O=[N+]([O-])c1nccn1CCCN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C18H20N6O2/c25-24(26)18-21-10-13-23(18)12-5-11-22(14-16-6-1-3-8-19-16)15-17-7-2-4-9-20-17/h1-4,6-10,13H,5,11-12,14-15H2 |
| InChIKey | ZQCRZTRAHBIJDQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|