C18H20N6O6S — CID 58090794
2-[4-[4-(2-nitroimidazol-1-yl)-3-oxobutyl]triazol-1-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 58090794) has the molecular formula C18H20N6O6S and a molecular weight of 448.46 g/mol. Its IUPAC name is 2-[4-[4-(2-nitroimidazol-1-yl)-3-oxobutyl]triazol-1-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[4-(2-nitroimidazol-1-yl)-3-oxobutyl]triazol-1-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58090794 |
| Molecular Formula | C18H20N6O6S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[4-[4-(2-nitroimidazol-1-yl)-3-oxobutyl]triazol-1-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCn2cc(CCC(=O)Cn3ccnc3[N+](=O)[O-])nn2)cc1 |
| InChI | InChI=1S/C18H20N6O6S/c1-14-2-6-17(7-3-14)31(28,29)30-11-10-23-12-15(20-21-23)4-5-16(25)13-22-9-8-19-18(22)24(26)27/h2-3,6-9,12H,4-5,10-11,13H2,1H3 |
| InChIKey | ROMKXCCMAWDRRP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 152.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|