C15H23FN6O5 — CID 46215582
4-[2-(2-(18F)fluoroethoxy)ethoxymethyl]-1-[3-[2-(2-nitroimidazol-1-yl)ethoxy]propyl]triazole (PubChem CID 46215582) has the molecular formula C15H23FN6O5 and a molecular weight of 385.39 g/mol. Its IUPAC name is 4-[2-(2-(18F)fluoroethoxy)ethoxymethyl]-1-[3-[2-(2-nitroimidazol-1-yl)ethoxy]propyl]triazole.
| Compound Name | 4-[2-(2-(18F)fluoroethoxy)ethoxymethyl]-1-[3-[2-(2-nitroimidazol-1-yl)ethoxy]propyl]triazole |
|---|---|
| PubChem CID | 46215582 |
| Molecular Formula | C15H23FN6O5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[2-(2-(18F)fluoroethoxy)ethoxymethyl]-1-[3-[2-(2-nitroimidazol-1-yl)ethoxy]propyl]triazole |
| SMILES | O=[N+]([O-])c1nccn1CCOCCCn1cc(COCCOCC[18F])nn1 |
| InChI | InChI=1S/C15H23FN6O5/c16-2-8-26-10-11-27-13-14-12-21(19-18-14)4-1-7-25-9-6-20-5-3-17-15(20)22(23)24/h3,5,12H,1-2,4,6-11,13H2/i16-1 |
| InChIKey | NDHWEJCZWGVXOS-GKTGUEEDSA-N |
| XLogP | 0.99 |
| TPSA | 119.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|