C32H45N3O9 — CID 86724822
1-[2-[2-[2-[2-[5-[(2R,3S)-4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-nitroimidazole (PubChem CID 86724822) has the molecular formula C32H45N3O9 and a molecular weight of 615.72 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[5-[(2R,3S)-4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-nitroimidazole.
| Compound Name | 1-[2-[2-[2-[2-[5-[(2R,3S)-4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-nitroimidazole |
|---|---|
| PubChem CID | 86724822 |
| Molecular Formula | C32H45N3O9 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | 1-[2-[2-[2-[2-[5-[(2R,3S)-4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-nitroimidazole |
| SMILES | COc1ccc(C[C@H](C)[C@H](C)Cc2ccc(OC)c(OCCOCCOCCOCCn3ccnc3[N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C32H45N3O9/c1-24(20-26-6-8-28(38-3)30(22-26)40-5)25(2)21-27-7-9-29(39-4)31(23-27)44-19-18-43-17-16-42-15-14-41-13-12-34-11-10-33-32(34)35(36)37/h6-11,22-25H,12-21H2,1-5H3/t24-,25+/m0/s1 |
| InChIKey | BQHSHAMHTJSTIZ-LOSJGSFVSA-N |
| XLogP | 5.00 |
| TPSA | 125.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|