C14H9N3O3 — CID 177333947
2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione (PubChem CID 177333947) has the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione.
| Compound Name | 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177333947 |
| Molecular Formula | C14H9N3O3 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cn2ccoc2n1 |
| InChI | InChI=1S/C14H9N3O3/c18-12-10-3-1-2-4-11(10)13(19)17(12)8-9-7-16-5-6-20-14(16)15-9/h1-7H,8H2 |
| InChIKey | KOGUFCDQOQJPRH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|