About 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione
2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione (PubChem CID 177333947) has the molecular formula C14H9N3O3
and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione |
| PubChem CID | 177333947 |
| Molecular Formula | C14H9N3O3 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cn2ccoc2n1 |
| InChI | InChI=1S/C14H9N3O3/c18-12-10-3-1-2-4-11(10)13(19)17(12)8-9-7-16-5-6-20-14(16)15-9/h1-7H,8H2 |
| InChIKey | KOGUFCDQOQJPRH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione?
The IUPAC name of 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione (CID 177333947) is 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione.
What is the SMILES notation for 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione?
The canonical SMILES for 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1Cc1cn2ccoc2n1.
What is the InChIKey of 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione?
The InChIKey is KOGUFCDQOQJPRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O3/c18-12-10-3-1-2-4-11(10)13(19)17(12)8-9-7-16-5-6-20-14(16)15-9/h1-7H,8H2.
What are the key properties of 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione?
2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione has a molecular weight of 267.24 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(imidazo[2,1-b][1,3]oxazol-6-ylmethyl)isoindole-1,3-dione is sourced from PubChem (CID 177333947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).