C12H8N2O3S — CID 139614682
2-[(2-oxo-3H-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione (PubChem CID 139614682) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 2-[(2-oxo-3H-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(2-oxo-3H-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139614682 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-[(2-oxo-3H-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1c[nH]c(=O)s1 |
| InChI | InChI=1S/C12H8N2O3S/c15-10-8-3-1-2-4-9(8)11(16)14(10)6-7-5-13-12(17)18-7/h1-5H,6H2,(H,13,17) |
| InChIKey | RLPUKVBIXYEVCT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|