C14H9FN2O3 — CID 162374915
2-[(5-fluoro-2-oxo-1H-pyridin-3-yl)methyl]isoindole-1,3-dione (PubChem CID 162374915) has the molecular formula C14H9FN2O3 and a molecular weight of 272.24 g/mol. Its IUPAC name is 2-[(5-fluoro-2-oxo-1H-pyridin-3-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(5-fluoro-2-oxo-1H-pyridin-3-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162374915 |
| Molecular Formula | C14H9FN2O3 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[(5-fluoro-2-oxo-1H-pyridin-3-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(F)c[nH]c1=O |
| InChI | InChI=1S/C14H9FN2O3/c15-9-5-8(12(18)16-6-9)7-17-13(19)10-3-1-2-4-11(10)14(17)20/h1-6H,7H2,(H,16,18) |
| InChIKey | UUMZZTADJZGAGU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|