C17H12N4O2 — CID 82199246
1-[4-(aminomethyl)triazol-1-yl]anthracene-9,10-dione (PubChem CID 82199246) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[4-(aminomethyl)triazol-1-yl]anthracene-9,10-dione.
| Compound Name | 1-[4-(aminomethyl)triazol-1-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 82199246 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[4-(aminomethyl)triazol-1-yl]anthracene-9,10-dione |
| SMILES | NCc1cn(-c2cccc3c2C(=O)c2ccccc2C3=O)nn1 |
| InChI | InChI=1S/C17H12N4O2/c18-8-10-9-21(20-19-10)14-7-3-6-13-15(14)17(23)12-5-2-1-4-11(12)16(13)22/h1-7,9H,8,18H2 |
| InChIKey | UGQDIEOYRTVLDQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|