C18H11N3O3 — CID 94938900
1-(9,10-dioxoanthracen-1-yl)-5-methyltriazole-4-carbaldehyde (PubChem CID 94938900) has the molecular formula C18H11N3O3 and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-(9,10-dioxoanthracen-1-yl)-5-methyltriazole-4-carbaldehyde.
| Compound Name | 1-(9,10-dioxoanthracen-1-yl)-5-methyltriazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94938900 |
| Molecular Formula | C18H11N3O3 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(9,10-dioxoanthracen-1-yl)-5-methyltriazole-4-carbaldehyde |
| SMILES | Cc1c(C=O)nnn1-c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H11N3O3/c1-10-14(9-22)19-20-21(10)15-8-4-7-13-16(15)18(24)12-6-3-2-5-11(12)17(13)23/h2-9H,1H3 |
| InChIKey | SVQRVDGNLDDFLP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|