C13H10N4OS — CID 82220814
5-(2-methylphenyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde (PubChem CID 82220814) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 5-(2-methylphenyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde.
| Compound Name | 5-(2-methylphenyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82220814 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-(2-methylphenyl)-1-(1,3-thiazol-2-yl)triazole-4-carbaldehyde |
| SMILES | Cc1ccccc1-c1c(C=O)nnn1-c1nccs1 |
| InChI | InChI=1S/C13H10N4OS/c1-9-4-2-3-5-10(9)12-11(8-18)15-16-17(12)13-14-6-7-19-13/h2-8H,1H3 |
| InChIKey | OGRLZNUCLWFVHJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|